C28H26FN3O4 — CID 108706486
N-[4-[(3Z)-2-[4-(dimethylamino)phenyl]-3-[(4-fluoro-3-methylphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]phenyl]acetamide (PubChem CID 108706486) has the molecular formula C28H26FN3O4 and a molecular weight of 487.53 g/mol. Its IUPAC name is N-[4-[(3Z)-2-[4-(dimethylamino)phenyl]-3-[(4-fluoro-3-methylphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]phenyl]acetamide.
| Compound Name | N-[4-[(3Z)-2-[4-(dimethylamino)phenyl]-3-[(4-fluoro-3-methylphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 108706486 |
| Molecular Formula | C28H26FN3O4 |
| Molecular Weight | 487.53 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | N-[4-[(3Z)-2-[4-(dimethylamino)phenyl]-3-[(4-fluoro-3-methylphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N2C(=O)C(=O)/C(=C(\O)c3ccc(F)c(C)c3)C2c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C28H26FN3O4/c1-16-15-19(7-14-23(16)29)26(34)24-25(18-5-10-21(11-6-18)31(3)4)32(28(36)27(24)35)22-12-8-20(9-13-22)30-17(2)33/h5-15,25,34H,1-4H3,(H,30,33)/b26-24- |
| InChIKey | CBBVIZBDBHFLHW-LCUIJRPUSA-N |
| XLogP | 4.78 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.53 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|