C21H30O2 — CID 10870752
(4aS,6S,8aS)-2,5,5,8a-tetramethyl-6-phenylmethoxy-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-one (PubChem CID 10870752) has the molecular formula C21H30O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is (4aS,6S,8aS)-2,5,5,8a-tetramethyl-6-phenylmethoxy-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-one.
| Compound Name | (4aS,6S,8aS)-2,5,5,8a-tetramethyl-6-phenylmethoxy-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 10870752 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | (4aS,6S,8aS)-2,5,5,8a-tetramethyl-6-phenylmethoxy-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-one |
| SMILES | CC1CC[C@H]2C(C)(C)[C@@H](OCc3ccccc3)CC[C@]2(C)C1=O |
| InChI | InChI=1S/C21H30O2/c1-15-10-11-17-20(2,3)18(12-13-21(17,4)19(15)22)23-14-16-8-6-5-7-9-16/h5-9,15,17-18H,10-14H2,1-4H3/t15?,17-,18-,21-/m0/s1 |
| InChIKey | CBBOKEANCCJXME-DDDQHCDISA-N |
| XLogP | 5.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |