C28H25FN4O3 — CID 108707581
(4E)-5-[4-(dimethylamino)phenyl]-4-[(4-ethylphenyl)-hydroxymethylidene]-1-(6-fluoro-1H-benzimidazol-2-yl)pyrrolidine-2,3-dione (PubChem CID 108707581) has the molecular formula C28H25FN4O3 and a molecular weight of 484.53 g/mol. Its IUPAC name is (4E)-5-[4-(dimethylamino)phenyl]-4-[(4-ethylphenyl)-hydroxymethylidene]-1-(6-fluoro-1H-benzimidazol-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-[4-(dimethylamino)phenyl]-4-[(4-ethylphenyl)-hydroxymethylidene]-1-(6-fluoro-1H-benzimidazol-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108707581 |
| Molecular Formula | C28H25FN4O3 |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | (4E)-5-[4-(dimethylamino)phenyl]-4-[(4-ethylphenyl)-hydroxymethylidene]-1-(6-fluoro-1H-benzimidazol-2-yl)pyrrolidine-2,3-dione |
| SMILES | CCc1ccc(/C(O)=C2\C(=O)C(=O)N(c3nc4ccc(F)cc4[nH]3)C2c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C28H25FN4O3/c1-4-16-5-7-18(8-6-16)25(34)23-24(17-9-12-20(13-10-17)32(2)3)33(27(36)26(23)35)28-30-21-14-11-19(29)15-22(21)31-28/h5-15,24,34H,4H2,1-3H3,(H,30,31)/b25-23+ |
| InChIKey | UXHSWOSJOAOADK-WJTDDFOZSA-N |
| XLogP | 4.96 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|