C27H23ClN4O4 — CID 108707689
(4E)-4-[(4-chlorophenyl)-hydroxymethylidene]-5-[4-(dimethylamino)phenyl]-1-(6-methoxy-1H-benzimidazol-2-yl)pyrrolidine-2,3-dione (PubChem CID 108707689) has the molecular formula C27H23ClN4O4 and a molecular weight of 502.96 g/mol. Its IUPAC name is (4E)-4-[(4-chlorophenyl)-hydroxymethylidene]-5-[4-(dimethylamino)phenyl]-1-(6-methoxy-1H-benzimidazol-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(4-chlorophenyl)-hydroxymethylidene]-5-[4-(dimethylamino)phenyl]-1-(6-methoxy-1H-benzimidazol-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108707689 |
| Molecular Formula | C27H23ClN4O4 |
| Molecular Weight | 502.96 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | (4E)-4-[(4-chlorophenyl)-hydroxymethylidene]-5-[4-(dimethylamino)phenyl]-1-(6-methoxy-1H-benzimidazol-2-yl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc2nc(N3C(=O)C(=O)/C(=C(/O)c4ccc(Cl)cc4)C3c3ccc(N(C)C)cc3)[nH]c2c1 |
| InChI | InChI=1S/C27H23ClN4O4/c1-31(2)18-10-6-15(7-11-18)23-22(24(33)16-4-8-17(28)9-5-16)25(34)26(35)32(23)27-29-20-13-12-19(36-3)14-21(20)30-27/h4-14,23,33H,1-3H3,(H,29,30)/b24-22+ |
| InChIKey | UYUIYINIVDRUHY-ZNTNEXAZSA-N |
| XLogP | 4.92 |
| TPSA | 98.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.96 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|