C25H14Cl2F2N2O5S — CID 108709235
(4E)-4-[(3,5-dichloro-4-methoxyphenyl)-hydroxymethylidene]-1-(5,6-difluoro-1,3-benzothiazol-2-yl)-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108709235) has the molecular formula C25H14Cl2F2N2O5S and a molecular weight of 563.37 g/mol. Its IUPAC name is (4E)-4-[(3,5-dichloro-4-methoxyphenyl)-hydroxymethylidene]-1-(5,6-difluoro-1,3-benzothiazol-2-yl)-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3,5-dichloro-4-methoxyphenyl)-hydroxymethylidene]-1-(5,6-difluoro-1,3-benzothiazol-2-yl)-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108709235 |
| Molecular Formula | C25H14Cl2F2N2O5S |
| Molecular Weight | 563.37 g/mol |
| Exact Mass | 562.00 |
| IUPAC Name | (4E)-4-[(3,5-dichloro-4-methoxyphenyl)-hydroxymethylidene]-1-(5,6-difluoro-1,3-benzothiazol-2-yl)-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1c(Cl)cc(/C(O)=C2\C(=O)C(=O)N(c3nc4cc(F)c(F)cc4s3)C2c2ccc(O)cc2)cc1Cl |
| InChI | InChI=1S/C25H14Cl2F2N2O5S/c1-36-23-13(26)6-11(7-14(23)27)21(33)19-20(10-2-4-12(32)5-3-10)31(24(35)22(19)34)25-30-17-8-15(28)16(29)9-18(17)37-25/h2-9,20,32-33H,1H3/b21-19+ |
| InChIKey | ZSPHUFBAXVVWJK-XUTLUUPISA-N |
| XLogP | 6.22 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.37 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|