C26H18Cl2N2O6S — CID 108709393
(4E)-4-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-5-(4-hydroxyphenyl)-1-(6-methoxy-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione (PubChem CID 108709393) has the molecular formula C26H18Cl2N2O6S and a molecular weight of 557.41 g/mol. Its IUPAC name is (4E)-4-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-5-(4-hydroxyphenyl)-1-(6-methoxy-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-5-(4-hydroxyphenyl)-1-(6-methoxy-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108709393 |
| Molecular Formula | C26H18Cl2N2O6S |
| Molecular Weight | 557.41 g/mol |
| Exact Mass | 556.03 |
| IUPAC Name | (4E)-4-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-5-(4-hydroxyphenyl)-1-(6-methoxy-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc2nc(N3C(=O)C(=O)/C(=C(/O)c4cc(Cl)cc(Cl)c4OC)C3c3ccc(O)cc3)sc2c1 |
| InChI | InChI=1S/C26H18Cl2N2O6S/c1-35-15-7-8-18-19(11-15)37-26(29-18)30-21(12-3-5-14(31)6-4-12)20(23(33)25(30)34)22(32)16-9-13(27)10-17(28)24(16)36-2/h3-11,21,31-32H,1-2H3/b22-20+ |
| InChIKey | WBHFJORDOUFJRF-LSDHQDQOSA-N |
| XLogP | 5.95 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.41 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|