C12H7ClF4N2O2 — CID 10871001
2-chloro-4-fluoro-5-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]benzoic acid (PubChem CID 10871001) has the molecular formula C12H7ClF4N2O2 and a molecular weight of 322.65 g/mol. Its IUPAC name is 2-chloro-4-fluoro-5-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]benzoic acid.
| Compound Name | 2-chloro-4-fluoro-5-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]benzoic acid |
|---|---|
| PubChem CID | 10871001 |
| Molecular Formula | C12H7ClF4N2O2 |
| Molecular Weight | 322.65 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | 2-chloro-4-fluoro-5-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]benzoic acid |
| SMILES | Cn1nc(-c2cc(C(=O)O)c(Cl)cc2F)cc1C(F)(F)F |
| InChI | InChI=1S/C12H7ClF4N2O2/c1-19-10(12(15,16)17)4-9(18-19)6-2-5(11(20)21)7(13)3-8(6)14/h2-4H,1H3,(H,20,21) |
| InChIKey | HQQFSYCAXAZRTJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.65 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |