C12H6Cl2F4N2O2 — CID 15334490
2-chloro-5-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-4-fluorobenzoic acid (PubChem CID 15334490) has the molecular formula C12H6Cl2F4N2O2 and a molecular weight of 357.09 g/mol. Its IUPAC name is 2-chloro-5-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-4-fluorobenzoic acid.
| Compound Name | 2-chloro-5-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 15334490 |
| Molecular Formula | C12H6Cl2F4N2O2 |
| Molecular Weight | 357.09 g/mol |
| Exact Mass | 355.97 |
| IUPAC Name | 2-chloro-5-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-4-fluorobenzoic acid |
| SMILES | Cn1nc(-c2cc(C(=O)O)c(Cl)cc2F)c(Cl)c1C(F)(F)F |
| InChI | InChI=1S/C12H6Cl2F4N2O2/c1-20-10(12(16,17)18)8(14)9(19-20)5-2-4(11(21)22)6(13)3-7(5)15/h2-3H,1H3,(H,21,22) |
| InChIKey | WVYCADDBKFWQOA-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.09 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |