C13H9Cl2F3N2O3 — CID 15671960
methyl 2-chloro-5-[4-chloro-5-(difluoromethoxy)-1-methylpyrazol-3-yl]-4-fluorobenzoate (PubChem CID 15671960) has the molecular formula C13H9Cl2F3N2O3 and a molecular weight of 369.13 g/mol. Its IUPAC name is methyl 2-chloro-5-[4-chloro-5-(difluoromethoxy)-1-methylpyrazol-3-yl]-4-fluorobenzoate.
| Compound Name | methyl 2-chloro-5-[4-chloro-5-(difluoromethoxy)-1-methylpyrazol-3-yl]-4-fluorobenzoate |
|---|---|
| PubChem CID | 15671960 |
| Molecular Formula | C13H9Cl2F3N2O3 |
| Molecular Weight | 369.13 g/mol |
| Exact Mass | 367.99 |
| IUPAC Name | methyl 2-chloro-5-[4-chloro-5-(difluoromethoxy)-1-methylpyrazol-3-yl]-4-fluorobenzoate |
| SMILES | COC(=O)c1cc(-c2nn(C)c(OC(F)F)c2Cl)c(F)cc1Cl |
| InChI | InChI=1S/C13H9Cl2F3N2O3/c1-20-11(23-13(17)18)9(15)10(19-20)6-3-5(12(21)22-2)7(14)4-8(6)16/h3-4,13H,1-2H3 |
| InChIKey | RTMNMAVZBXUOKA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.13 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |