C27H33N3O3 — CID 108713253
3-(2,2-dimethylpropanoyl)-4-hydroxy-2-(3-methylphenyl)-1-[4-(4-methylpiperazin-1-yl)phenyl]-2H-pyrrol-5-one (PubChem CID 108713253) has the molecular formula C27H33N3O3 and a molecular weight of 447.58 g/mol. Its IUPAC name is 3-(2,2-dimethylpropanoyl)-4-hydroxy-2-(3-methylphenyl)-1-[4-(4-methylpiperazin-1-yl)phenyl]-2H-pyrrol-5-one.
| Compound Name | 3-(2,2-dimethylpropanoyl)-4-hydroxy-2-(3-methylphenyl)-1-[4-(4-methylpiperazin-1-yl)phenyl]-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108713253 |
| Molecular Formula | C27H33N3O3 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | 3-(2,2-dimethylpropanoyl)-4-hydroxy-2-(3-methylphenyl)-1-[4-(4-methylpiperazin-1-yl)phenyl]-2H-pyrrol-5-one |
| SMILES | Cc1cccc(C2C(C(=O)C(C)(C)C)=C(O)C(=O)N2c2ccc(N3CCN(C)CC3)cc2)c1 |
| InChI | InChI=1S/C27H33N3O3/c1-18-7-6-8-19(17-18)23-22(25(32)27(2,3)4)24(31)26(33)30(23)21-11-9-20(10-12-21)29-15-13-28(5)14-16-29/h6-12,17,23,31H,13-16H2,1-5H3 |
| InChIKey | OBMQGUCXSODMJP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|