C24H15F2N3O3S — CID 108714716
(4E)-1-(4,6-difluoro-1,3-benzothiazol-2-yl)-4-[hydroxy(pyridin-4-yl)methylidene]-5-(3-methylphenyl)pyrrolidine-2,3-dione (PubChem CID 108714716) has the molecular formula C24H15F2N3O3S and a molecular weight of 463.47 g/mol. Its IUPAC name is (4E)-1-(4,6-difluoro-1,3-benzothiazol-2-yl)-4-[hydroxy(pyridin-4-yl)methylidene]-5-(3-methylphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(4,6-difluoro-1,3-benzothiazol-2-yl)-4-[hydroxy(pyridin-4-yl)methylidene]-5-(3-methylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108714716 |
| Molecular Formula | C24H15F2N3O3S |
| Molecular Weight | 463.47 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | (4E)-1-(4,6-difluoro-1,3-benzothiazol-2-yl)-4-[hydroxy(pyridin-4-yl)methylidene]-5-(3-methylphenyl)pyrrolidine-2,3-dione |
| SMILES | Cc1cccc(C2/C(=C(\O)c3ccncc3)C(=O)C(=O)N2c2nc3c(F)cc(F)cc3s2)c1 |
| InChI | InChI=1S/C24H15F2N3O3S/c1-12-3-2-4-14(9-12)20-18(21(30)13-5-7-27-8-6-13)22(31)23(32)29(20)24-28-19-16(26)10-15(25)11-17(19)33-24/h2-11,20,30H,1H3/b21-18+ |
| InChIKey | WTBPMTZFANRRIK-DYTRJAOYSA-N |
| XLogP | 4.90 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.47 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|