C34H37NO6 — CID 108717599
(4E)-5-(4-tert-butylphenyl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-[hydroxy-(4-pentoxyphenyl)methylidene]pyrrolidine-2,3-dione (PubChem CID 108717599) has the molecular formula C34H37NO6 and a molecular weight of 555.67 g/mol. Its IUPAC name is (4E)-5-(4-tert-butylphenyl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-[hydroxy-(4-pentoxyphenyl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(4-tert-butylphenyl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-[hydroxy-(4-pentoxyphenyl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108717599 |
| Molecular Formula | C34H37NO6 |
| Molecular Weight | 555.67 g/mol |
| Exact Mass | 555.26 |
| IUPAC Name | (4E)-5-(4-tert-butylphenyl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-[hydroxy-(4-pentoxyphenyl)methylidene]pyrrolidine-2,3-dione |
| SMILES | CCCCCOc1ccc(/C(O)=C2\C(=O)C(=O)N(c3ccc4c(c3)OCCO4)C2c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C34H37NO6/c1-5-6-7-18-39-26-15-10-23(11-16-26)31(36)29-30(22-8-12-24(13-9-22)34(2,3)4)35(33(38)32(29)37)25-14-17-27-28(21-25)41-20-19-40-27/h8-17,21,30,36H,5-7,18-20H2,1-4H3/b31-29+ |
| InChIKey | QWVMRQTYWSFJRK-OWWNRXNESA-N |
| XLogP | 6.95 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.67 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|