C35H29NO3 — CID 108718630
(4E)-5-(4-tert-butylphenyl)-4-[hydroxy(naphthalen-1-yl)methylidene]-1-naphthalen-1-ylpyrrolidine-2,3-dione (PubChem CID 108718630) has the molecular formula C35H29NO3 and a molecular weight of 511.62 g/mol. Its IUPAC name is (4E)-5-(4-tert-butylphenyl)-4-[hydroxy(naphthalen-1-yl)methylidene]-1-naphthalen-1-ylpyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(4-tert-butylphenyl)-4-[hydroxy(naphthalen-1-yl)methylidene]-1-naphthalen-1-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108718630 |
| Molecular Formula | C35H29NO3 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | (4E)-5-(4-tert-butylphenyl)-4-[hydroxy(naphthalen-1-yl)methylidene]-1-naphthalen-1-ylpyrrolidine-2,3-dione |
| SMILES | CC(C)(C)c1ccc(C2/C(=C(\O)c3cccc4ccccc34)C(=O)C(=O)N2c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C35H29NO3/c1-35(2,3)25-20-18-24(19-21-25)31-30(32(37)28-16-8-12-22-10-4-6-14-26(22)28)33(38)34(39)36(31)29-17-9-13-23-11-5-7-15-27(23)29/h4-21,31,37H,1-3H3/b32-30+ |
| InChIKey | WPRYSCFDXQFDCS-NHQGMKOOSA-N |
| XLogP | 7.92 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|