C33H30N2O4 — CID 108718456
N-[4-[(3Z)-2-(4-tert-butylphenyl)-3-[hydroxy(naphthalen-1-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]phenyl]acetamide (PubChem CID 108718456) has the molecular formula C33H30N2O4 and a molecular weight of 518.61 g/mol. Its IUPAC name is N-[4-[(3Z)-2-(4-tert-butylphenyl)-3-[hydroxy(naphthalen-1-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]phenyl]acetamide.
| Compound Name | N-[4-[(3Z)-2-(4-tert-butylphenyl)-3-[hydroxy(naphthalen-1-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 108718456 |
| Molecular Formula | C33H30N2O4 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | N-[4-[(3Z)-2-(4-tert-butylphenyl)-3-[hydroxy(naphthalen-1-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N2C(=O)C(=O)/C(=C(\O)c3cccc4ccccc34)C2c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C33H30N2O4/c1-20(36)34-24-16-18-25(19-17-24)35-29(22-12-14-23(15-13-22)33(2,3)4)28(31(38)32(35)39)30(37)27-11-7-9-21-8-5-6-10-26(21)27/h5-19,29,37H,1-4H3,(H,34,36)/b30-28- |
| InChIKey | URMFYNYOVWFUAX-HYOGKJQXSA-N |
| XLogP | 6.72 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|