C30H24N2O5 — CID 108667063
N-[3-[(3Z)-3-[hydroxy(naphthalen-1-yl)methylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetamide (PubChem CID 108667063) has the molecular formula C30H24N2O5 and a molecular weight of 492.53 g/mol. Its IUPAC name is N-[3-[(3Z)-3-[hydroxy(naphthalen-1-yl)methylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetamide.
| Compound Name | N-[3-[(3Z)-3-[hydroxy(naphthalen-1-yl)methylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 108667063 |
| Molecular Formula | C30H24N2O5 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | N-[3-[(3Z)-3-[hydroxy(naphthalen-1-yl)methylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetamide |
| SMILES | COc1cccc(C2/C(=C(/O)c3cccc4ccccc34)C(=O)C(=O)N2c2cccc(NC(C)=O)c2)c1 |
| InChI | InChI=1S/C30H24N2O5/c1-18(33)31-21-11-7-12-22(17-21)32-27(20-10-5-13-23(16-20)37-2)26(29(35)30(32)36)28(34)25-15-6-9-19-8-3-4-14-24(19)25/h3-17,27,34H,1-2H3,(H,31,33)/b28-26- |
| InChIKey | RNEXVOUYIYERNZ-SGEDCAFJSA-N |
| XLogP | 5.43 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|