C15H20N2O8 — CID 10871975
(2S)-2-[nitroso-[[(3S,4R,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methyl]amino]-3-phenylpropanoic acid (PubChem CID 10871975) has the molecular formula C15H20N2O8 and a molecular weight of 356.33 g/mol. Its IUPAC name is (2S)-2-[nitroso-[[(3S,4R,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[nitroso-[[(3S,4R,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 10871975 |
| Molecular Formula | C15H20N2O8 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | (2S)-2-[nitroso-[[(3S,4R,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methyl]amino]-3-phenylpropanoic acid |
| SMILES | O=NN(CC1(O)OC[C@@H](O)[C@@H](O)[C@@H]1O)[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C15H20N2O8/c18-11-7-25-15(23,13(20)12(11)19)8-17(16-24)10(14(21)22)6-9-4-2-1-3-5-9/h1-5,10-13,18-20,23H,6-8H2,(H,21,22)/t10-,11+,12+,13-,15?/m0/s1 |
| InChIKey | OPZOTSHRJJJDRF-VJDSNFAGSA-N |
| XLogP | -1.53 |
| TPSA | 160.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|