C30H27Cl2N3O4 — CID 108719913
(4E)-5-(4-tert-butylphenyl)-4-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-1-(6-methyl-1H-benzimidazol-2-yl)pyrrolidine-2,3-dione (PubChem CID 108719913) has the molecular formula C30H27Cl2N3O4 and a molecular weight of 564.47 g/mol. Its IUPAC name is (4E)-5-(4-tert-butylphenyl)-4-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-1-(6-methyl-1H-benzimidazol-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(4-tert-butylphenyl)-4-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-1-(6-methyl-1H-benzimidazol-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108719913 |
| Molecular Formula | C30H27Cl2N3O4 |
| Molecular Weight | 564.47 g/mol |
| Exact Mass | 563.14 |
| IUPAC Name | (4E)-5-(4-tert-butylphenyl)-4-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-1-(6-methyl-1H-benzimidazol-2-yl)pyrrolidine-2,3-dione |
| SMILES | COc1c(Cl)cc(Cl)cc1/C(O)=C1\C(=O)C(=O)N(c2nc3ccc(C)cc3[nH]2)C1c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C30H27Cl2N3O4/c1-15-6-11-21-22(12-15)34-29(33-21)35-24(16-7-9-17(10-8-16)30(2,3)4)23(26(37)28(35)38)25(36)19-13-18(31)14-20(32)27(19)39-5/h6-14,24,36H,1-5H3,(H,33,34)/b25-23+ |
| InChIKey | AYEPOIMLQTYWTP-WJTDDFOZSA-N |
| XLogP | 7.11 |
| TPSA | 95.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.47 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|