C29H26ClN3O6 — CID 108715284
(4E)-4-[(3-chloro-2-methoxy-5-methylphenyl)-hydroxymethylidene]-1-(5,6-dimethoxy-1H-benzimidazol-2-yl)-5-(3-methylphenyl)pyrrolidine-2,3-dione (PubChem CID 108715284) has the molecular formula C29H26ClN3O6 and a molecular weight of 548.00 g/mol. Its IUPAC name is (4E)-4-[(3-chloro-2-methoxy-5-methylphenyl)-hydroxymethylidene]-1-(5,6-dimethoxy-1H-benzimidazol-2-yl)-5-(3-methylphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3-chloro-2-methoxy-5-methylphenyl)-hydroxymethylidene]-1-(5,6-dimethoxy-1H-benzimidazol-2-yl)-5-(3-methylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108715284 |
| Molecular Formula | C29H26ClN3O6 |
| Molecular Weight | 548.00 g/mol |
| Exact Mass | 547.15 |
| IUPAC Name | (4E)-4-[(3-chloro-2-methoxy-5-methylphenyl)-hydroxymethylidene]-1-(5,6-dimethoxy-1H-benzimidazol-2-yl)-5-(3-methylphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1cc2nc(N3C(=O)C(=O)/C(=C(/O)c4cc(C)cc(Cl)c4OC)C3c3cccc(C)c3)[nH]c2cc1OC |
| InChI | InChI=1S/C29H26ClN3O6/c1-14-7-6-8-16(9-14)24-23(25(34)17-10-15(2)11-18(30)27(17)39-5)26(35)28(36)33(24)29-31-19-12-21(37-3)22(38-4)13-20(19)32-29/h6-13,24,34H,1-5H3,(H,31,32)/b25-23+ |
| InChIKey | ZBEXOPIROVVNJX-WJTDDFOZSA-N |
| XLogP | 5.49 |
| TPSA | 113.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.00 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|