C23H11Cl3FN3O3S — CID 108723210
(4E)-1-(5-chloro-6-fluoro-1,3-benzothiazol-2-yl)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-5-pyridin-2-ylpyrrolidine-2,3-dione (PubChem CID 108723210) has the molecular formula C23H11Cl3FN3O3S and a molecular weight of 534.78 g/mol. Its IUPAC name is (4E)-1-(5-chloro-6-fluoro-1,3-benzothiazol-2-yl)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-5-pyridin-2-ylpyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(5-chloro-6-fluoro-1,3-benzothiazol-2-yl)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-5-pyridin-2-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108723210 |
| Molecular Formula | C23H11Cl3FN3O3S |
| Molecular Weight | 534.78 g/mol |
| Exact Mass | 532.96 |
| IUPAC Name | (4E)-1-(5-chloro-6-fluoro-1,3-benzothiazol-2-yl)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-5-pyridin-2-ylpyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2nc3cc(Cl)c(F)cc3s2)C(c2ccccn2)/C1=C(\O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H11Cl3FN3O3S/c24-11-5-4-10(7-12(11)25)20(31)18-19(15-3-1-2-6-28-15)30(22(33)21(18)32)23-29-16-8-13(26)14(27)9-17(16)34-23/h1-9,19,31H/b20-18+ |
| InChIKey | AXWXTALTRUNCRR-CZIZESTLSA-N |
| XLogP | 6.42 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.78 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|