C26H20FN3O4S — CID 108723382
(4E)-4-[(4-fluoro-3-methylphenyl)-hydroxymethylidene]-1-(6-methoxy-5-methyl-1,3-benzothiazol-2-yl)-5-pyridin-2-ylpyrrolidine-2,3-dione (PubChem CID 108723382) has the molecular formula C26H20FN3O4S and a molecular weight of 489.53 g/mol. Its IUPAC name is (4E)-4-[(4-fluoro-3-methylphenyl)-hydroxymethylidene]-1-(6-methoxy-5-methyl-1,3-benzothiazol-2-yl)-5-pyridin-2-ylpyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(4-fluoro-3-methylphenyl)-hydroxymethylidene]-1-(6-methoxy-5-methyl-1,3-benzothiazol-2-yl)-5-pyridin-2-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108723382 |
| Molecular Formula | C26H20FN3O4S |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | (4E)-4-[(4-fluoro-3-methylphenyl)-hydroxymethylidene]-1-(6-methoxy-5-methyl-1,3-benzothiazol-2-yl)-5-pyridin-2-ylpyrrolidine-2,3-dione |
| SMILES | COc1cc2sc(N3C(=O)C(=O)/C(=C(/O)c4ccc(F)c(C)c4)C3c3ccccn3)nc2cc1C |
| InChI | InChI=1S/C26H20FN3O4S/c1-13-10-15(7-8-16(13)27)23(31)21-22(17-6-4-5-9-28-17)30(25(33)24(21)32)26-29-18-11-14(2)19(34-3)12-20(18)35-26/h4-12,22,31H,1-3H3/b23-21+ |
| InChIKey | BZXSSWPAFDFNMK-XTQSDGFTSA-N |
| XLogP | 5.08 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|