C27H22ClN3O5S — CID 108723423
(4E)-4-[(3-chloro-2-methoxy-5-methylphenyl)-hydroxymethylidene]-1-(6-methoxy-5-methyl-1,3-benzothiazol-2-yl)-5-pyridin-2-ylpyrrolidine-2,3-dione (PubChem CID 108723423) has the molecular formula C27H22ClN3O5S and a molecular weight of 536.01 g/mol. Its IUPAC name is (4E)-4-[(3-chloro-2-methoxy-5-methylphenyl)-hydroxymethylidene]-1-(6-methoxy-5-methyl-1,3-benzothiazol-2-yl)-5-pyridin-2-ylpyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3-chloro-2-methoxy-5-methylphenyl)-hydroxymethylidene]-1-(6-methoxy-5-methyl-1,3-benzothiazol-2-yl)-5-pyridin-2-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108723423 |
| Molecular Formula | C27H22ClN3O5S |
| Molecular Weight | 536.01 g/mol |
| Exact Mass | 535.10 |
| IUPAC Name | (4E)-4-[(3-chloro-2-methoxy-5-methylphenyl)-hydroxymethylidene]-1-(6-methoxy-5-methyl-1,3-benzothiazol-2-yl)-5-pyridin-2-ylpyrrolidine-2,3-dione |
| SMILES | COc1cc2sc(N3C(=O)C(=O)/C(=C(/O)c4cc(C)cc(Cl)c4OC)C3c3ccccn3)nc2cc1C |
| InChI | InChI=1S/C27H22ClN3O5S/c1-13-9-15(25(36-4)16(28)10-13)23(32)21-22(17-7-5-6-8-29-17)31(26(34)24(21)33)27-30-18-11-14(2)19(35-3)12-20(18)37-27/h5-12,22,32H,1-4H3/b23-21+ |
| InChIKey | MSUVYNMARPMBQF-XTQSDGFTSA-N |
| XLogP | 5.61 |
| TPSA | 101.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.01 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|