C29H28N2O5 — CID 108724146
propyl 4-[[(4Z)-4-[(3,4-dimethylphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]methyl]benzoate (PubChem CID 108724146) has the molecular formula C29H28N2O5 and a molecular weight of 484.55 g/mol. Its IUPAC name is propyl 4-[[(4Z)-4-[(3,4-dimethylphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]methyl]benzoate.
| Compound Name | propyl 4-[[(4Z)-4-[(3,4-dimethylphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 108724146 |
| Molecular Formula | C29H28N2O5 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | propyl 4-[[(4Z)-4-[(3,4-dimethylphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]methyl]benzoate |
| SMILES | CCCOC(=O)c1ccc(CN2C(=O)C(=O)/C(=C(\O)c3ccc(C)c(C)c3)C2c2cccnc2)cc1 |
| InChI | InChI=1S/C29H28N2O5/c1-4-14-36-29(35)21-11-8-20(9-12-21)17-31-25(23-6-5-13-30-16-23)24(27(33)28(31)34)26(32)22-10-7-18(2)19(3)15-22/h5-13,15-16,25,32H,4,14,17H2,1-3H3/b26-24- |
| InChIKey | ZXUVVRFVKIBRKD-LCUIJRPUSA-N |
| XLogP | 4.89 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|