C27H23BrN2O5 — CID 108673456
propyl 4-[(4Z)-4-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]benzoate (PubChem CID 108673456) has the molecular formula C27H23BrN2O5 and a molecular weight of 535.39 g/mol. Its IUPAC name is propyl 4-[(4Z)-4-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]benzoate.
| Compound Name | propyl 4-[(4Z)-4-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 108673456 |
| Molecular Formula | C27H23BrN2O5 |
| Molecular Weight | 535.39 g/mol |
| Exact Mass | 534.08 |
| IUPAC Name | propyl 4-[(4Z)-4-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]benzoate |
| SMILES | CCCOC(=O)c1ccc(N2C(=O)C(=O)/C(=C(\O)c3ccc(Br)c(C)c3)C2c2cccnc2)cc1 |
| InChI | InChI=1S/C27H23BrN2O5/c1-3-13-35-27(34)17-6-9-20(10-7-17)30-23(19-5-4-12-29-15-19)22(25(32)26(30)33)24(31)18-8-11-21(28)16(2)14-18/h4-12,14-15,23,31H,3,13H2,1-2H3/b24-22- |
| InChIKey | NUTOOAHRHRMYRA-GYHWCHFESA-N |
| XLogP | 5.35 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.39 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|