C28H25NO5 — CID 108714077
propyl 4-[(3E)-3-[hydroxy(phenyl)methylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 108714077) has the molecular formula C28H25NO5 and a molecular weight of 455.51 g/mol. Its IUPAC name is propyl 4-[(3E)-3-[hydroxy(phenyl)methylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | propyl 4-[(3E)-3-[hydroxy(phenyl)methylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 108714077 |
| Molecular Formula | C28H25NO5 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | propyl 4-[(3E)-3-[hydroxy(phenyl)methylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCCOC(=O)c1ccc(N2C(=O)C(=O)/C(=C(/O)c3ccccc3)C2c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C28H25NO5/c1-3-16-34-28(33)20-12-14-22(15-13-20)29-24(21-11-7-8-18(2)17-21)23(26(31)27(29)32)25(30)19-9-5-4-6-10-19/h4-15,17,24,30H,3,16H2,1-2H3/b25-23+ |
| InChIKey | DJWNPVCAZDTASJ-WJTDDFOZSA-N |
| XLogP | 5.19 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|