C30H29NO5 — CID 108714005
propyl 3-[(3E)-3-[(4-ethylphenyl)-hydroxymethylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 108714005) has the molecular formula C30H29NO5 and a molecular weight of 483.56 g/mol. Its IUPAC name is propyl 3-[(3E)-3-[(4-ethylphenyl)-hydroxymethylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | propyl 3-[(3E)-3-[(4-ethylphenyl)-hydroxymethylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 108714005 |
| Molecular Formula | C30H29NO5 |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | propyl 3-[(3E)-3-[(4-ethylphenyl)-hydroxymethylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCCOC(=O)c1cccc(N2C(=O)C(=O)/C(=C(/O)c3ccc(CC)cc3)C2c2cccc(C)c2)c1 |
| InChI | InChI=1S/C30H29NO5/c1-4-16-36-30(35)23-10-7-11-24(18-23)31-26(22-9-6-8-19(3)17-22)25(28(33)29(31)34)27(32)21-14-12-20(5-2)13-15-21/h6-15,17-18,26,32H,4-5,16H2,1-3H3/b27-25+ |
| InChIKey | IANRNGZQUAWQPS-IMVLJIQESA-N |
| XLogP | 5.75 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|