C31H29NO6 — CID 108714052
propyl 3-[(3Z)-3-[3,4-dihydro-2H-chromen-6-yl(hydroxy)methylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 108714052) has the molecular formula C31H29NO6 and a molecular weight of 511.57 g/mol. Its IUPAC name is propyl 3-[(3Z)-3-[3,4-dihydro-2H-chromen-6-yl(hydroxy)methylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | propyl 3-[(3Z)-3-[3,4-dihydro-2H-chromen-6-yl(hydroxy)methylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 108714052 |
| Molecular Formula | C31H29NO6 |
| Molecular Weight | 511.57 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | propyl 3-[(3Z)-3-[3,4-dihydro-2H-chromen-6-yl(hydroxy)methylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCCOC(=O)c1cccc(N2C(=O)C(=O)/C(=C(\O)c3ccc4c(c3)CCCO4)C2c2cccc(C)c2)c1 |
| InChI | InChI=1S/C31H29NO6/c1-3-14-38-31(36)23-9-5-11-24(18-23)32-27(21-8-4-7-19(2)16-21)26(29(34)30(32)35)28(33)22-12-13-25-20(17-22)10-6-15-37-25/h4-5,7-9,11-13,16-18,27,33H,3,6,10,14-15H2,1-2H3/b28-26- |
| InChIKey | MPQQJCNPVLOMEP-SGEDCAFJSA-N |
| XLogP | 5.51 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.57 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|