C31H30N2O6 — CID 108714022
propyl 3-[(3Z)-3-[hydroxy-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)methylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 108714022) has the molecular formula C31H30N2O6 and a molecular weight of 526.59 g/mol. Its IUPAC name is propyl 3-[(3Z)-3-[hydroxy-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)methylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | propyl 3-[(3Z)-3-[hydroxy-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)methylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 108714022 |
| Molecular Formula | C31H30N2O6 |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | propyl 3-[(3Z)-3-[hydroxy-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)methylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCCOC(=O)c1cccc(N2C(=O)C(=O)/C(=C(\O)c3ccc4c(c3)N(C)CCO4)C2c2cccc(C)c2)c1 |
| InChI | InChI=1S/C31H30N2O6/c1-4-14-39-31(37)22-9-6-10-23(17-22)33-27(20-8-5-7-19(2)16-20)26(29(35)30(33)36)28(34)21-11-12-25-24(18-21)32(3)13-15-38-25/h5-12,16-18,27,34H,4,13-15H2,1-3H3/b28-26- |
| InChIKey | AOAXJVGVAIZZSX-SGEDCAFJSA-N |
| XLogP | 5.02 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|