C27H24N2O5 — CID 108714020
propyl 3-[(3E)-3-[hydroxy(pyridin-4-yl)methylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 108714020) has the molecular formula C27H24N2O5 and a molecular weight of 456.50 g/mol. Its IUPAC name is propyl 3-[(3E)-3-[hydroxy(pyridin-4-yl)methylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | propyl 3-[(3E)-3-[hydroxy(pyridin-4-yl)methylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 108714020 |
| Molecular Formula | C27H24N2O5 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | propyl 3-[(3E)-3-[hydroxy(pyridin-4-yl)methylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCCOC(=O)c1cccc(N2C(=O)C(=O)/C(=C(/O)c3ccncc3)C2c2cccc(C)c2)c1 |
| InChI | InChI=1S/C27H24N2O5/c1-3-14-34-27(33)20-8-5-9-21(16-20)29-23(19-7-4-6-17(2)15-19)22(25(31)26(29)32)24(30)18-10-12-28-13-11-18/h4-13,15-16,23,30H,3,14H2,1-2H3/b24-22+ |
| InChIKey | QCQDSHKKEUTOIW-ZNTNEXAZSA-N |
| XLogP | 4.58 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|