C28H26N2O6 — CID 108724468
2-methylpropyl 4-[(4E)-4-[hydroxy-(2-methoxyphenyl)methylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]benzoate (PubChem CID 108724468) has the molecular formula C28H26N2O6 and a molecular weight of 486.52 g/mol. Its IUPAC name is 2-methylpropyl 4-[(4E)-4-[hydroxy-(2-methoxyphenyl)methylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]benzoate.
| Compound Name | 2-methylpropyl 4-[(4E)-4-[hydroxy-(2-methoxyphenyl)methylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 108724468 |
| Molecular Formula | C28H26N2O6 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 2-methylpropyl 4-[(4E)-4-[hydroxy-(2-methoxyphenyl)methylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]benzoate |
| SMILES | COc1ccccc1/C(O)=C1\C(=O)C(=O)N(c2ccc(C(=O)OCC(C)C)cc2)C1c1cccnc1 |
| InChI | InChI=1S/C28H26N2O6/c1-17(2)16-36-28(34)18-10-12-20(13-11-18)30-24(19-7-6-14-29-15-19)23(26(32)27(30)33)25(31)21-8-4-5-9-22(21)35-3/h4-15,17,24,31H,16H2,1-3H3/b25-23+ |
| InChIKey | HAAZZTVIVXRNBR-WJTDDFOZSA-N |
| XLogP | 4.53 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|