C29H26Cl2N2O7 — CID 108724548
2-methylpropyl 4-[(4E)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]benzoate (PubChem CID 108724548) has the molecular formula C29H26Cl2N2O7 and a molecular weight of 585.44 g/mol. Its IUPAC name is 2-methylpropyl 4-[(4E)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]benzoate.
| Compound Name | 2-methylpropyl 4-[(4E)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 108724548 |
| Molecular Formula | C29H26Cl2N2O7 |
| Molecular Weight | 585.44 g/mol |
| Exact Mass | 584.11 |
| IUPAC Name | 2-methylpropyl 4-[(4E)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]benzoate |
| SMILES | COc1c(Cl)cc(/C(O)=C2\C(=O)C(=O)N(c3ccc(C(=O)OCC(C)C)cc3)C2c2cccnc2)c(OC)c1Cl |
| InChI | InChI=1S/C29H26Cl2N2O7/c1-15(2)14-40-29(37)16-7-9-18(10-8-16)33-23(17-6-5-11-32-13-17)21(25(35)28(33)36)24(34)19-12-20(30)27(39-4)22(31)26(19)38-3/h5-13,15,23,34H,14H2,1-4H3/b24-21+ |
| InChIKey | SDIBLKYDNGNUEJ-DARPEHSRSA-N |
| XLogP | 5.84 |
| TPSA | 115.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.44 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|