C30H27Cl2NO6 — CID 108714262
2-methylpropyl 4-[(3E)-3-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 108714262) has the molecular formula C30H27Cl2NO6 and a molecular weight of 568.45 g/mol. Its IUPAC name is 2-methylpropyl 4-[(3E)-3-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | 2-methylpropyl 4-[(3E)-3-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 108714262 |
| Molecular Formula | C30H27Cl2NO6 |
| Molecular Weight | 568.45 g/mol |
| Exact Mass | 567.12 |
| IUPAC Name | 2-methylpropyl 4-[(3E)-3-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | COc1c(Cl)cc(Cl)cc1/C(O)=C1\C(=O)C(=O)N(c2ccc(C(=O)OCC(C)C)cc2)C1c1cccc(C)c1 |
| InChI | InChI=1S/C30H27Cl2NO6/c1-16(2)15-39-30(37)18-8-10-21(11-9-18)33-25(19-7-5-6-17(3)12-19)24(27(35)29(33)36)26(34)22-13-20(31)14-23(32)28(22)38-4/h5-14,16,25,34H,15H2,1-4H3/b26-24+ |
| InChIKey | URAGYWMAMNLTRA-SHHOIMCASA-N |
| XLogP | 6.75 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.45 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|