C30H28ClNO6 — CID 108713979
propan-2-yl 3-[(3E)-3-[(3-chloro-2-methoxy-5-methylphenyl)-hydroxymethylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 108713979) has the molecular formula C30H28ClNO6 and a molecular weight of 534.01 g/mol. Its IUPAC name is propan-2-yl 3-[(3E)-3-[(3-chloro-2-methoxy-5-methylphenyl)-hydroxymethylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | propan-2-yl 3-[(3E)-3-[(3-chloro-2-methoxy-5-methylphenyl)-hydroxymethylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 108713979 |
| Molecular Formula | C30H28ClNO6 |
| Molecular Weight | 534.01 g/mol |
| Exact Mass | 533.16 |
| IUPAC Name | propan-2-yl 3-[(3E)-3-[(3-chloro-2-methoxy-5-methylphenyl)-hydroxymethylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | COc1c(Cl)cc(C)cc1/C(O)=C1\C(=O)C(=O)N(c2cccc(C(=O)OC(C)C)c2)C1c1cccc(C)c1 |
| InChI | InChI=1S/C30H28ClNO6/c1-16(2)38-30(36)20-10-7-11-21(15-20)32-25(19-9-6-8-17(3)12-19)24(27(34)29(32)35)26(33)22-13-18(4)14-23(31)28(22)37-5/h6-16,25,33H,1-5H3/b26-24+ |
| InChIKey | XVBCFLAGIMDEEZ-SHHOIMCASA-N |
| XLogP | 6.16 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.01 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|