C28H24ClNO5 — CID 108713929
propan-2-yl 3-[(3E)-3-[(3-chlorophenyl)-hydroxymethylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 108713929) has the molecular formula C28H24ClNO5 and a molecular weight of 489.96 g/mol. Its IUPAC name is propan-2-yl 3-[(3E)-3-[(3-chlorophenyl)-hydroxymethylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | propan-2-yl 3-[(3E)-3-[(3-chlorophenyl)-hydroxymethylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 108713929 |
| Molecular Formula | C28H24ClNO5 |
| Molecular Weight | 489.96 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | propan-2-yl 3-[(3E)-3-[(3-chlorophenyl)-hydroxymethylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | Cc1cccc(C2/C(=C(\O)c3cccc(Cl)c3)C(=O)C(=O)N2c2cccc(C(=O)OC(C)C)c2)c1 |
| InChI | InChI=1S/C28H24ClNO5/c1-16(2)35-28(34)20-10-6-12-22(15-20)30-24(18-8-4-7-17(3)13-18)23(26(32)27(30)33)25(31)19-9-5-11-21(29)14-19/h4-16,24,31H,1-3H3/b25-23+ |
| InChIKey | OYRCEUIXNOFGMX-WJTDDFOZSA-N |
| XLogP | 5.84 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.96 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|