C17H18ClN5O3 — CID 10872494
6-chloro-N-[[(2S)-1,4-diazabicyclo[2.2.2]octan-2-yl]methyl]-5-nitroquinoline-8-carboxamide (PubChem CID 10872494) has the molecular formula C17H18ClN5O3 and a molecular weight of 375.82 g/mol. Its IUPAC name is 6-chloro-N-[[(2S)-1,4-diazabicyclo[2.2.2]octan-2-yl]methyl]-5-nitroquinoline-8-carboxamide.
| Compound Name | 6-chloro-N-[[(2S)-1,4-diazabicyclo[2.2.2]octan-2-yl]methyl]-5-nitroquinoline-8-carboxamide |
|---|---|
| PubChem CID | 10872494 |
| Molecular Formula | C17H18ClN5O3 |
| Molecular Weight | 375.82 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 6-chloro-N-[[(2S)-1,4-diazabicyclo[2.2.2]octan-2-yl]methyl]-5-nitroquinoline-8-carboxamide |
| SMILES | O=C(NC[C@H]1CN2CCN1CC2)c1cc(Cl)c([N+](=O)[O-])c2cccnc12 |
| InChI | InChI=1S/C17H18ClN5O3/c18-14-8-13(15-12(2-1-3-19-15)16(14)23(25)26)17(24)20-9-11-10-21-4-6-22(11)7-5-21/h1-3,8,11H,4-7,9-10H2,(H,20,24)/t11-/m0/s1 |
| InChIKey | BRAJDXJILUWRCU-NSHDSACASA-N |
| XLogP | 1.53 |
| TPSA | 91.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.82 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|