C14H18N4O3 — CID 90567495
N-(1,4-diazabicyclo[2.2.2]octan-2-ylmethyl)-3-nitrobenzamide (PubChem CID 90567495) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is N-(1,4-diazabicyclo[2.2.2]octan-2-ylmethyl)-3-nitrobenzamide.
| Compound Name | N-(1,4-diazabicyclo[2.2.2]octan-2-ylmethyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 90567495 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | N-(1,4-diazabicyclo[2.2.2]octan-2-ylmethyl)-3-nitrobenzamide |
| SMILES | O=C(NCC1CN2CCN1CC2)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H18N4O3/c19-14(11-2-1-3-12(8-11)18(20)21)15-9-13-10-16-4-6-17(13)7-5-16/h1-3,8,13H,4-7,9-10H2,(H,15,19) |
| InChIKey | VCKVLILIDZPCEA-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|