C21H24N2O2 — CID 108726437
N-(2-indol-1-ylethyl)-2-(2,3,5-trimethylphenoxy)acetamide (PubChem CID 108726437) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is N-(2-indol-1-ylethyl)-2-(2,3,5-trimethylphenoxy)acetamide.
| Compound Name | N-(2-indol-1-ylethyl)-2-(2,3,5-trimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 108726437 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | N-(2-indol-1-ylethyl)-2-(2,3,5-trimethylphenoxy)acetamide |
| SMILES | Cc1cc(C)c(C)c(OCC(=O)NCCn2ccc3ccccc32)c1 |
| InChI | InChI=1S/C21H24N2O2/c1-15-12-16(2)17(3)20(13-15)25-14-21(24)22-9-11-23-10-8-18-6-4-5-7-19(18)23/h4-8,10,12-13H,9,11,14H2,1-3H3,(H,22,24) |
| InChIKey | MMOOETWASAHDJG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |