C21H20N4O2S — CID 108727880
N-(6-phenyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)-2-(2,3,5-trimethylphenoxy)acetamide (PubChem CID 108727880) has the molecular formula C21H20N4O2S and a molecular weight of 392.48 g/mol. Its IUPAC name is N-(6-phenyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)-2-(2,3,5-trimethylphenoxy)acetamide.
| Compound Name | N-(6-phenyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)-2-(2,3,5-trimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 108727880 |
| Molecular Formula | C21H20N4O2S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | N-(6-phenyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)-2-(2,3,5-trimethylphenoxy)acetamide |
| SMILES | Cc1cc(C)c(C)c(OCC(=O)Nc2nc3scc(-c4ccccc4)n3n2)c1 |
| InChI | InChI=1S/C21H20N4O2S/c1-13-9-14(2)15(3)18(10-13)27-11-19(26)22-20-23-21-25(24-20)17(12-28-21)16-7-5-4-6-8-16/h4-10,12H,11H2,1-3H3,(H,22,24,26) |
| InChIKey | DANSAWVOHUDWGL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |