C22H22N4O2S — CID 108752016
N-[6-(4-methylphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-2-(2,3,6-trimethylphenoxy)acetamide (PubChem CID 108752016) has the molecular formula C22H22N4O2S and a molecular weight of 406.51 g/mol. Its IUPAC name is N-[6-(4-methylphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-2-(2,3,6-trimethylphenoxy)acetamide.
| Compound Name | N-[6-(4-methylphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-2-(2,3,6-trimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 108752016 |
| Molecular Formula | C22H22N4O2S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | N-[6-(4-methylphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-2-(2,3,6-trimethylphenoxy)acetamide |
| SMILES | Cc1ccc(-c2csc3nc(NC(=O)COc4c(C)ccc(C)c4C)nn23)cc1 |
| InChI | InChI=1S/C22H22N4O2S/c1-13-5-9-17(10-6-13)18-12-29-22-24-21(25-26(18)22)23-19(27)11-28-20-15(3)8-7-14(2)16(20)4/h5-10,12H,11H2,1-4H3,(H,23,25,27) |
| InChIKey | KHJHXPSEDYMDHZ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |