C13H10ClFN4O2S — CID 108728333
2-chloroethyl N-[6-(4-fluorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]carbamate (PubChem CID 108728333) has the molecular formula C13H10ClFN4O2S and a molecular weight of 340.77 g/mol. Its IUPAC name is 2-chloroethyl N-[6-(4-fluorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]carbamate.
| Compound Name | 2-chloroethyl N-[6-(4-fluorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]carbamate |
|---|---|
| PubChem CID | 108728333 |
| Molecular Formula | C13H10ClFN4O2S |
| Molecular Weight | 340.77 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | 2-chloroethyl N-[6-(4-fluorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]carbamate |
| SMILES | O=C(Nc1nc2scc(-c3ccc(F)cc3)n2n1)OCCCl |
| InChI | InChI=1S/C13H10ClFN4O2S/c14-5-6-21-13(20)17-11-16-12-19(18-11)10(7-22-12)8-1-3-9(15)4-2-8/h1-4,7H,5-6H2,(H,17,18,20) |
| InChIKey | OFVGEIAWJIIYGO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.77 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|