C14H20N4OS — CID 108729375
1,1-diethyl-3-[2-(4-thiophen-2-yl-1H-imidazol-5-yl)ethyl]urea (PubChem CID 108729375) has the molecular formula C14H20N4OS and a molecular weight of 292.41 g/mol. Its IUPAC name is 1,1-diethyl-3-[2-(4-thiophen-2-yl-1H-imidazol-5-yl)ethyl]urea.
| Compound Name | 1,1-diethyl-3-[2-(4-thiophen-2-yl-1H-imidazol-5-yl)ethyl]urea |
|---|---|
| PubChem CID | 108729375 |
| Molecular Formula | C14H20N4OS |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 1,1-diethyl-3-[2-(4-thiophen-2-yl-1H-imidazol-5-yl)ethyl]urea |
| SMILES | CCN(CC)C(=O)NCCc1[nH]cnc1-c1cccs1 |
| InChI | InChI=1S/C14H20N4OS/c1-3-18(4-2)14(19)15-8-7-11-13(17-10-16-11)12-6-5-9-20-12/h5-6,9-10H,3-4,7-8H2,1-2H3,(H,15,19)(H,16,17) |
| InChIKey | KMYFQQJPTUJLRX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |