C18H19N3O3S — CID 108753068
2,6-dimethoxy-N-[2-(4-thiophen-2-yl-1H-imidazol-5-yl)ethyl]benzamide (PubChem CID 108753068) has the molecular formula C18H19N3O3S and a molecular weight of 357.44 g/mol. Its IUPAC name is 2,6-dimethoxy-N-[2-(4-thiophen-2-yl-1H-imidazol-5-yl)ethyl]benzamide.
| Compound Name | 2,6-dimethoxy-N-[2-(4-thiophen-2-yl-1H-imidazol-5-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 108753068 |
| Molecular Formula | C18H19N3O3S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 2,6-dimethoxy-N-[2-(4-thiophen-2-yl-1H-imidazol-5-yl)ethyl]benzamide |
| SMILES | COc1cccc(OC)c1C(=O)NCCc1[nH]cnc1-c1cccs1 |
| InChI | InChI=1S/C18H19N3O3S/c1-23-13-5-3-6-14(24-2)16(13)18(22)19-9-8-12-17(21-11-20-12)15-7-4-10-25-15/h3-7,10-11H,8-9H2,1-2H3,(H,19,22)(H,20,21) |
| InChIKey | LIZRSGCORXYJLQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |