C22H18N4O3S2 — CID 108729893
3-[(E)-3-oxo-3-[4-(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]prop-1-enyl]chromen-4-one (PubChem CID 108729893) has the molecular formula C22H18N4O3S2 and a molecular weight of 450.55 g/mol. Its IUPAC name is 3-[(E)-3-oxo-3-[4-(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]prop-1-enyl]chromen-4-one.
| Compound Name | 3-[(E)-3-oxo-3-[4-(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]prop-1-enyl]chromen-4-one |
|---|---|
| PubChem CID | 108729893 |
| Molecular Formula | C22H18N4O3S2 |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | 3-[(E)-3-oxo-3-[4-(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]prop-1-enyl]chromen-4-one |
| SMILES | O=C(/C=C/c1coc2ccccc2c1=O)N1CCN(c2nnc(-c3cccs3)s2)CC1 |
| InChI | InChI=1S/C22H18N4O3S2/c27-19(8-7-15-14-29-17-5-2-1-4-16(17)20(15)28)25-9-11-26(12-10-25)22-24-23-21(31-22)18-6-3-13-30-18/h1-8,13-14H,9-12H2/b8-7+ |
| InChIKey | CHXUBIUFKQCYMV-BQYQJAHWSA-N |
| XLogP | 3.73 |
| TPSA | 79.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|