C19H19NO5 — CID 108731401
methyl 1-[(E)-3-(4-oxochromen-3-yl)prop-2-enoyl]piperidine-3-carboxylate (PubChem CID 108731401) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is methyl 1-[(E)-3-(4-oxochromen-3-yl)prop-2-enoyl]piperidine-3-carboxylate.
| Compound Name | methyl 1-[(E)-3-(4-oxochromen-3-yl)prop-2-enoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 108731401 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | methyl 1-[(E)-3-(4-oxochromen-3-yl)prop-2-enoyl]piperidine-3-carboxylate |
| SMILES | COC(=O)C1CCCN(C(=O)/C=C/c2coc3ccccc3c2=O)C1 |
| InChI | InChI=1S/C19H19NO5/c1-24-19(23)13-5-4-10-20(11-13)17(21)9-8-14-12-25-16-7-3-2-6-15(16)18(14)22/h2-3,6-9,12-13H,4-5,10-11H2,1H3/b9-8+ |
| InChIKey | URNJJQJWTUHABZ-CMDGGOBGSA-N |
| XLogP | 2.22 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|