C20H25N3O2 — CID 95782017
(3S)-N,N-dimethyl-1-[(E)-3-(1-methylindol-3-yl)prop-2-enoyl]piperidine-3-carboxamide (PubChem CID 95782017) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is (3S)-N,N-dimethyl-1-[(E)-3-(1-methylindol-3-yl)prop-2-enoyl]piperidine-3-carboxamide.
| Compound Name | (3S)-N,N-dimethyl-1-[(E)-3-(1-methylindol-3-yl)prop-2-enoyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95782017 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | (3S)-N,N-dimethyl-1-[(E)-3-(1-methylindol-3-yl)prop-2-enoyl]piperidine-3-carboxamide |
| SMILES | CN(C)C(=O)[C@H]1CCCN(C(=O)/C=C/c2cn(C)c3ccccc23)C1 |
| InChI | InChI=1S/C20H25N3O2/c1-21(2)20(25)16-7-6-12-23(14-16)19(24)11-10-15-13-22(3)18-9-5-4-8-17(15)18/h4-5,8-11,13,16H,6-7,12,14H2,1-3H3/b11-10+/t16-/m0/s1 |
| InChIKey | YSANMNNKGKOTMR-OFAQMXQXSA-N |
| XLogP | 2.52 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|