C17H21NO3 — CID 78919453
methyl (3S)-1-[(E)-3-(3-methylphenyl)prop-2-enoyl]piperidine-3-carboxylate (PubChem CID 78919453) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is methyl (3S)-1-[(E)-3-(3-methylphenyl)prop-2-enoyl]piperidine-3-carboxylate.
| Compound Name | methyl (3S)-1-[(E)-3-(3-methylphenyl)prop-2-enoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 78919453 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | methyl (3S)-1-[(E)-3-(3-methylphenyl)prop-2-enoyl]piperidine-3-carboxylate |
| SMILES | COC(=O)[C@H]1CCCN(C(=O)/C=C/c2cccc(C)c2)C1 |
| InChI | InChI=1S/C17H21NO3/c1-13-5-3-6-14(11-13)8-9-16(19)18-10-4-7-15(12-18)17(20)21-2/h3,5-6,8-9,11,15H,4,7,10,12H2,1-2H3/b9-8+/t15-/m0/s1 |
| InChIKey | ZQXUIZHCOPLINH-HVHJFMEUSA-N |
| XLogP | 2.42 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|