C14H19N3O3 — CID 78919115
methyl 1-[(E)-3-(1-methylpyrazol-4-yl)prop-2-enoyl]piperidine-3-carboxylate (PubChem CID 78919115) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is methyl 1-[(E)-3-(1-methylpyrazol-4-yl)prop-2-enoyl]piperidine-3-carboxylate.
| Compound Name | methyl 1-[(E)-3-(1-methylpyrazol-4-yl)prop-2-enoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 78919115 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | methyl 1-[(E)-3-(1-methylpyrazol-4-yl)prop-2-enoyl]piperidine-3-carboxylate |
| SMILES | COC(=O)C1CCCN(C(=O)/C=C/c2cnn(C)c2)C1 |
| InChI | InChI=1S/C14H19N3O3/c1-16-9-11(8-15-16)5-6-13(18)17-7-3-4-12(10-17)14(19)20-2/h5-6,8-9,12H,3-4,7,10H2,1-2H3/b6-5+ |
| InChIKey | OOCLILNVWHCJRZ-AATRIKPKSA-N |
| XLogP | 0.84 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|