C16H18BrNO3 — CID 78919406
methyl (3S)-1-[(E)-3-(3-bromophenyl)prop-2-enoyl]piperidine-3-carboxylate (PubChem CID 78919406) has the molecular formula C16H18BrNO3 and a molecular weight of 352.23 g/mol. Its IUPAC name is methyl (3S)-1-[(E)-3-(3-bromophenyl)prop-2-enoyl]piperidine-3-carboxylate.
| Compound Name | methyl (3S)-1-[(E)-3-(3-bromophenyl)prop-2-enoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 78919406 |
| Molecular Formula | C16H18BrNO3 |
| Molecular Weight | 352.23 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | methyl (3S)-1-[(E)-3-(3-bromophenyl)prop-2-enoyl]piperidine-3-carboxylate |
| SMILES | COC(=O)[C@H]1CCCN(C(=O)/C=C/c2cccc(Br)c2)C1 |
| InChI | InChI=1S/C16H18BrNO3/c1-21-16(20)13-5-3-9-18(11-13)15(19)8-7-12-4-2-6-14(17)10-12/h2,4,6-8,10,13H,3,5,9,11H2,1H3/b8-7+/t13-/m0/s1 |
| InChIKey | BYZRPOGOXKNIRG-GWJCSSMESA-N |
| XLogP | 2.87 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.23 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|