About N-[6-[[2-(3,5-dichloro-2-pyridinyl)-5-methylpyrazol-3-yl]amino]-6-oxohexyl]benzamide
N-[6-[[2-(3,5-dichloro-2-pyridinyl)-5-methylpyrazol-3-yl]amino]-6-oxohexyl]benzamide (PubChem CID 108732627) has the molecular formula C22H23Cl2N5O2
and a molecular weight of 460.37 g/mol. Its IUPAC name is N-[6-[[2-(3,5-dichloro-2-pyridinyl)-5-methylpyrazol-3-yl]amino]-6-oxohexyl]benzamide.
Molecular Properties
| Compound Name | N-[6-[[2-(3,5-dichloro-2-pyridinyl)-5-methylpyrazol-3-yl]amino]-6-oxohexyl]benzamide |
| PubChem CID | 108732627 |
| Molecular Formula | C22H23Cl2N5O2 |
| Molecular Weight | 460.37 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | N-[6-[[2-(3,5-dichloro-2-pyridinyl)-5-methylpyrazol-3-yl]amino]-6-oxohexyl]benzamide |
| SMILES | Cc1cc(NC(=O)CCCCCNC(=O)c2ccccc2)n(-c2ncc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C22H23Cl2N5O2/c1-15-12-19(29(28-15)21-18(24)13-17(23)14-26-21)27-20(30)10-6-3-7-11-25-22(31)16-8-4-2-5-9-16/h2,4-5,8-9,12-14H,3,6-7,10-11H2,1H3,(H,25,31)(H,27,30) |
| InChIKey | WQMHAUAOZBKVNL-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.37 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[6-[[2-(3,5-dichloro-2-pyridinyl)-5-methylpyrazol-3-yl]amino]-6-oxohexyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-[[2-(3,5-dichloro-2-pyridinyl)-5-methylpyrazol-3-yl]amino]-6-oxohexyl]benzamide?
The IUPAC name of N-[6-[[2-(3,5-dichloro-2-pyridinyl)-5-methylpyrazol-3-yl]amino]-6-oxohexyl]benzamide (CID 108732627) is N-[6-[[2-(3,5-dichloro-2-pyridinyl)-5-methylpyrazol-3-yl]amino]-6-oxohexyl]benzamide.
What is the SMILES notation for N-[6-[[2-(3,5-dichloro-2-pyridinyl)-5-methylpyrazol-3-yl]amino]-6-oxohexyl]benzamide?
The canonical SMILES for N-[6-[[2-(3,5-dichloro-2-pyridinyl)-5-methylpyrazol-3-yl]amino]-6-oxohexyl]benzamide is Cc1cc(NC(=O)CCCCCNC(=O)c2ccccc2)n(-c2ncc(Cl)cc2Cl)n1.
What is the InChIKey of N-[6-[[2-(3,5-dichloro-2-pyridinyl)-5-methylpyrazol-3-yl]amino]-6-oxohexyl]benzamide?
The InChIKey is WQMHAUAOZBKVNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23Cl2N5O2/c1-15-12-19(29(28-15)21-18(24)13-17(23)14-26-21)27-20(30)10-6-3-7-11-25-22(31)16-8-4-2-5-9-16/h2,4-5,8-9,12-14H,3,6-7,10-11H2,1H3,(H,25,31)(H,27,30).
What are the key properties of N-[6-[[2-(3,5-dichloro-2-pyridinyl)-5-methylpyrazol-3-yl]amino]-6-oxohexyl]benzamide?
N-[6-[[2-(3,5-dichloro-2-pyridinyl)-5-methylpyrazol-3-yl]amino]-6-oxohexyl]benzamide has a molecular weight of 460.37 g/mol, XLogP of 4.81, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-[[2-(3,5-dichloro-2-pyridinyl)-5-methylpyrazol-3-yl]amino]-6-oxohexyl]benzamide is sourced from PubChem (CID 108732627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).