C18H23N3O2 — CID 6486736
N-[6-(3,5-dimethylpyrazol-1-yl)-6-oxohexyl]benzamide (PubChem CID 6486736) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is N-[6-(3,5-dimethylpyrazol-1-yl)-6-oxohexyl]benzamide.
| Compound Name | N-[6-(3,5-dimethylpyrazol-1-yl)-6-oxohexyl]benzamide |
|---|---|
| PubChem CID | 6486736 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | N-[6-(3,5-dimethylpyrazol-1-yl)-6-oxohexyl]benzamide |
| SMILES | Cc1cc(C)n(C(=O)CCCCCNC(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C18H23N3O2/c1-14-13-15(2)21(20-14)17(22)11-7-4-8-12-19-18(23)16-9-5-3-6-10-16/h3,5-6,9-10,13H,4,7-8,11-12H2,1-2H3,(H,19,23) |
| InChIKey | YKIOOEKSQILRIZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|