C14H16N4O2S — CID 108733128
N-(3-ethylsulfanyl-1H-1,2,4-triazol-5-yl)-4-oxo-4-phenylbutanamide (PubChem CID 108733128) has the molecular formula C14H16N4O2S and a molecular weight of 304.38 g/mol. Its IUPAC name is N-(3-ethylsulfanyl-1H-1,2,4-triazol-5-yl)-4-oxo-4-phenylbutanamide.
| Compound Name | N-(3-ethylsulfanyl-1H-1,2,4-triazol-5-yl)-4-oxo-4-phenylbutanamide |
|---|---|
| PubChem CID | 108733128 |
| Molecular Formula | C14H16N4O2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | N-(3-ethylsulfanyl-1H-1,2,4-triazol-5-yl)-4-oxo-4-phenylbutanamide |
| SMILES | CCSc1n[nH]c(NC(=O)CCC(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C14H16N4O2S/c1-2-21-14-16-13(17-18-14)15-12(20)9-8-11(19)10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3,(H2,15,16,17,18,20) |
| InChIKey | JMPFOTRIOBTJQI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |